A1321612
(S)-(-)-1-Benzyl-3-pyrrolidinol , 99% , 101385-90-4
CAS NO.:101385-90-4
Empirical Formula: C11H15NO
Molecular Weight: 177.24
MDL number: MFCD00075485
EINECS: 600-202-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB68.80 | In Stock |
|
| 5G | RMB192.80 | In Stock |
|
| 25G | RMB624.80 | In Stock |
|
| 100g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -3.7 º (c=5, MeOH) |
| Boiling point: | 115 °C0.8 mm Hg(lit.) |
| Density | 1.07 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | 14.82±0.20(Predicted) |
| form | Liquid |
| color | Clear light yellow to pale brown |
| optical activity | [α]24/D 3.7°, c = 5 in methanol |
| BRN | 4982831 |
| InChI | InChI=1S/C11H15NO/c13-11-6-7-12(9-11)8-10-4-2-1-3-5-10/h1-5,11,13H,6-9H2/t11-/m0/s1 |
| InChIKey | YQMXOIAIYXXXEE-NSHDSACASA-N |
| SMILES | N1(CC2=CC=CC=C2)CC[C@H](O)C1 |
| CAS DataBase Reference | 101385-90-4(CAS DataBase Reference) |
Description and Uses
For synthesis of optically active products
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |






