A1321712
(R)-(+)-1-Benzyl-3-pyrrolidinol , 97% , 101930-07-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB145.60 | In Stock |
|
| 5G | RMB504.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | 3.7 º (c=5, MeOH) |
| Boiling point: | 116 °C0.9 mm Hg(lit.) |
| Density | 1.07 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | 14.82±0.20(Predicted) |
| form | clear liquid to slightly cloudy liquid |
| color | Light yellow to Yellow to Orange |
| Specific Gravity | 1.07 |
| optical activity | [α]23/D +3.7°, c = 5 in methanol |
| InChI | InChI=1S/C11H15NO/c13-11-6-7-12(9-11)8-10-4-2-1-3-5-10/h1-5,11,13H,6-9H2/t11-/m1/s1 |
| InChIKey | YQMXOIAIYXXXEE-LLVKDONJSA-N |
| SMILES | N1(CC2=CC=CC=C2)CC[C@@H](O)C1 |
| CAS DataBase Reference | 101930-07-8(CAS DataBase Reference) |
Description and Uses
(R)-(+)-1-Benzyl-3-pyrrolidinol, is a chiral building block used for the synthesis of various pharmaceutical and biologically active compounds. It can be used for the preparation of beta-proline like derivatives, acting as sodium channel blockers
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![(2S,4R)-1-[(R)-5-CHLORO-1-(2,4-DIMETHOXY-BENZENESULFONYL)-3-(2-METHOXY-PHENYL)-2-OXO-2,3-DIHYDRO-1H-INDOL-3-YL]-4-HYDROXY-PYRROLIDINE-2-CARBOXYLIC ACID DIMETHYLAMIDE](https://img.chemicalbook.com/CAS/GIF/439687-69-1.gif)


