A1321812
5-Bromopyridine-2-carboxaldehyde , 97% , 31181-90-5
Synonym(s):
5-Bromo-2-picolinaldehyde
CAS NO.：31181-90-5
Empirical Formula: C6H4BrNO
Molecular Weight: 186.01
MDL number: MFCD04112535
EINECS: 626-872-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB88.00 | In Stock |
|
| 25G | RMB367.20 | In Stock |
|
| 100g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 91-96 °C |
| Boiling point: | 70°C/26mmHg(lit.) |
| Density | 1.683±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 1.36±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C6H4BrNO/c7-5-1-2-6(4-9)8-3-5/h1-4H |
| InChIKey | ZQVLPMNLLKGGIU-UHFFFAOYSA-N |
| SMILES | C1(C=O)=NC=C(Br)C=C1 |
| CAS DataBase Reference | 31181-90-5(CAS DataBase Reference) |
Description and Uses
5-Bromopyridine-2-carboxaldehyde is used as organic chemical synthesis intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-26-36/37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
