A1322012
7-Bromoindole , 98% , 51417-51-7
CAS NO.：51417-51-7
Empirical Formula: C8H6BrN
Molecular Weight: 196.04
MDL number: MFCD00799492
EINECS: 625-873-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB64.00 | In Stock |
|
| 5G | RMB263.20 | In Stock |
|
| 25G | RMB1254.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-44 °C (lit.) |
| Boiling point: | 85-86°C 0,2mm |
| Density | 1.660±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 15.33±0.30(Predicted) |
| form | Crystalline Powder |
| color | Beige-yellow or brownish |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C8H6BrN/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5,10H |
| InChIKey | RDSVSEFWZUWZHW-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2Br)C=C1 |
| CAS DataBase Reference | 51417-51-7(CAS DataBase Reference) |
Description and Uses
7-Bromoindole may be used in the synthesis of the following:
- indole
- dyestuffs
- 8-bromocarboline
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339990 |
