A1324412
3-Bromopyridine-2-carbonitrile , 98% , 55758-02-6
Synonym(s):
3-Bromo-2-cyanopyridine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25g | RMB376.80 | In Stock |
|
| 100g | RMB1515.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-98 °C |
| Boiling point: | 120°C/4mm |
| Density | 1.72±0.1 g/cm3(Predicted) |
| Flash point: | 120°C/4mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Dichloromethane, Ether, Ethyl Acetate, Methanol |
| form | Powder or Crystalline Powder |
| pka | -2.68±0.10(Predicted) |
| color | White to pale brown |
| InChI | InChI=1S/C6H3BrN2/c7-5-2-1-3-9-6(5)4-8/h1-3H |
| InChIKey | HCOPIUVJCIZALB-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=CC=C1Br |
| CAS DataBase Reference | 55758-02-6(CAS DataBase Reference) |
Description and Uses
3-Bromopyridine-2-carbonitrile is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
