PRODUCT Properties
| Melting point: | 141-145 °C(lit.) |
| alpha | -49o (C=1% IN DMSO) |
| Density | 1.70 |
| refractive index | -48 ° (C=1, DMSO) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 7.87±0.43(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D -49°, c = 1% in DMSO |
| BRN | 632501 |
| InChIKey | NZDWTKFDAUOODA-CNEMSGBDSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)NC(=O)C3=CC=CC=C3)N=C2)[C@H](O)[C@@H]1O |
| CAS DataBase Reference | 4546-55-8(CAS DataBase Reference) |
Description and Uses
N6-Benzoyladenosine is an anti tumor agent.
