A1325612
Benzyl (S)-(+)-glycidyl ether , >98.0%(GC) , 16495-13-9
Synonym(s):
(S)-(+)-2-(Benzyloxymethyl)oxirane
CAS NO.：16495-13-9
Empirical Formula: C10H12O2
Molecular Weight: 164.2
MDL number: MFCD00054428
EINECS: 605-380-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB117.60 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| 500g | RMB1903.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | 5.1 º (c=5 in toluene) |
| Boiling point: | 130 °C (0.1 mmHg) |
| Density | 1.072 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | >110°C |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethanol |
| form | Oil |
| color | Colourless |
| Specific Gravity | 1.077 |
| optical activity | [α]20/D +5.1°, c = 5 in toluene |
| BRN | 5246495 |
| InChI | InChI=1S/C10H12O2/c1-2-4-9(5-3-1)6-11-7-10-8-12-10/h1-5,10H,6-8H2/t10-/m1/s1 |
| InChIKey | QNYBOILAKBSWFG-SNVBAGLBSA-N |
| SMILES | O1C[C@H]1COCC1=CC=CC=C1 |
| CAS DataBase Reference | 16495-13-9(CAS DataBase Reference) |
Description and Uses
(S)-(+)-Benzyl Glycidyl Ether is used as a reactant in the synthesis of (+)-Discodermolide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | TX2860030 |
| HS Code | 29109000 |
| Toxicity | mic-sat 660 nmol/plate MUREAV 298,197,1993 |
