A1325812
2-Bromo-4-fluoropyridine , 96% , 357927-50-5
Synonym(s):
4-Fluoro-2-bromopyridine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB66.40 | In Stock |
|
| 5G | RMB249.60 | In Stock |
|
| 25g | RMB844.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 188.8±20.0 °C(Predicted) |
| Density | 1.699 g/mL at 25 °C |
| Flash point: | 76°(169°F) |
| refractive index | 1.5370 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| pka | -0.33±0.10(Predicted) |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C5H3BrFN/c6-5-3-4(7)1-2-8-5/h1-3H |
| InChIKey | AIEATTRZKVGMBO-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(F)=C1 |
| CAS DataBase Reference | 357927-50-5(CAS DataBase Reference) |
Description and Uses
2-Bromo-4-fluoropyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| RIDADR | NA1993 |
| WGK Germany | 1 |
| HazardClass | CBL |
| HS Code | 29333990 |
| Excepted Quantities | Non-Hazardous |
