A1325912
2-Bromo-6-fluoropyridine , 98% , 144100-07-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB106.40 | In Stock |
|
| 25G | RMB277.60 | In Stock |
|
| 100G | RMB1191.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30-32°C |
| Boiling point: | 162-164°C |
| Density | 1.707±0.06 g/cm3(Predicted) |
| refractive index | 1.532 |
| Flash point: | 74.9° |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| pka | -4.87±0.10(Predicted) |
| color | White or Colorless to Light yellow |
| InChI | InChI=1S/C5H3BrFN/c6-4-2-1-3-5(7)8-4/h1-3H |
| InChIKey | ZIDIKYIZXMYHAW-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC(F)=CC=C1 |
| CAS DataBase Reference | 144100-07-2(CAS DataBase Reference) |
Description and Uses
2-Bromo-6-fluoropyridine is a versatile building block that can create a range of compounds, such as 2-Bromo-6-hydrazinylpyridine, 2-Amino-6-bromopyridine, etc. It is a useful intermediate and can be applied in synthesising high-quality reagents, speciality chemicals, and complex compounds. It has been used as a reaction component in synthesising 2-(2-bromoethoxy)pyridine and 2-bromopyridine.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H311-H315-H319-H332-H335 |
| Precautionary statements | P280h-P305+P351+P338-P309-P310 |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 36/37/38-20/21/22-10-41-37/38-22 |
| Safety Statements | 26-36/37/39-36-16-39 |
| RIDADR | UN2811 |
| WGK Germany | WGK 1 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |






