A1328812
5-Bromo-2-phenylpyridine , 95% , 27012-25-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB156.80 | In Stock |
|
| 1G | RMB316.80 | In Stock |
|
| 5G | RMB1063.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-75°C |
| Boiling point: | 309.3±22.0 °C(Predicted) |
| Density | 1.426±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in ethyl ether. |
| pka | 2.08±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C11H8BrN/c12-10-6-7-11(13-8-10)9-4-2-1-3-5-9/h1-8H |
| InChIKey | PRNGIODVYLTUKH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=NC=C(Br)C=C1 |
Description and Uses
5-Bromo-2-phenylpyridine is used as a ligand in coordination chemistry and reacts with iridium(III) chloride to get in tris-heteroleptic Iridium(III), which finds application as phosphorescent (triplet) emitters in organic light-emitting diodes (OLEDs) due to its self-emitting nature, fast response, wide viewing angle and low power consumption.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 29333990 |
