A1330412
6-Bromo-2-naphthoic acid , 98% , 5773-80-8
CAS NO.:5773-80-8
Empirical Formula: C11H7BrO2
Molecular Weight: 251.08
MDL number: MFCD01075720
EINECS: 611-572-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB207.20 | In Stock |
|
| 25G | RMB719.20 | In Stock |
|
| 100G | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 294-295°C |
| Boiling point: | 387.3±17.0 °C(Predicted) |
| Density | 1.648±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 4.06±0.30(Predicted) |
| color | White to Light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 2328940 |
| InChI | InChI=1S/C11H7BrO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,(H,13,14) |
| InChIKey | NPMCAVBMOTZUPD-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(Br)C=C2)=CC=C1C(O)=O |
| CAS DataBase Reference | 5773-80-8(CAS DataBase Reference) |
Description and Uses
Benzimidazole derivatives has been prepared by using ortho-phenyl diamine and 6-bromo-2-naphthoic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | WGK 3 |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |







