A1333350
Aluminumlactate , ≥95% , 18917-91-4
Synonym(s):
L -Lactic acid aluminum salt
CAS NO.:18917-91-4
Empirical Formula: C9H15AlO9
Molecular Weight: 294.19
MDL number: MFCD00043086
EINECS: 242-670-9
| Pack Size | Price | Stock | Quantity |
| 25g | RMB79.20 | In Stock |
|
| 100g | RMB215.20 | In Stock |
|
| 500g | RMB799.20 | In Stock |
|
| 2.5kg | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| alpha | 36620 +48.31°; 43620 +33.37°; 57820 +10.20° (c= 0.1 M); 366 25 +48.40°; 43625 +31.36°; 57825 +10.22° (c = 0.1 M) |
| Density | 1.388[at 20℃] |
| vapor pressure | 0.001Pa at 20℃ |
| solubility | very soluble in H2O |
| form | Powder |
| color | white |
| PH | pH(100g/l, 25℃) : 3.0~4.0 |
| Water Solubility | Very soluble in cold water |
| Merck | 14,348 |
| Cosmetics Ingredients Functions | BUFFERING DEODORANT ASTRINGENT |
| InChI | InChI=1S/3C3H6O3.Al/c3*1-2(4)3(5)6;/h3*2,4H,1H3,(H,5,6);/q;;;+3/p-3 |
| InChIKey | VXYADVIJALMOEQ-UHFFFAOYSA-K |
| SMILES | C(=O)(O[Al](OC(=O)C(O)C)OC(=O)C(O)C)C(O)C |
| LogP | -1.9 at 25℃ |
| CAS DataBase Reference | 18917-91-4(CAS DataBase Reference) |
| EPA Substance Registry System | Aluminum, tris(2-hydroxypropanoato-O1,O2)- (18917-91-4) |
Description and Uses
As a reagent in biological activity studies of aluminum; in sol-gel processing.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-26 |
| WGK Germany | 3 |
| RTECS | BD2214000 |
| TSCA | Yes |





