A1335512
Bromopyruvic acid , 96% , 1113-59-3
Synonym(s):
3-Bromo-2-oxopropionic acid;3-BrPA, Bromopyruvate, Bromopyruvatic Acid, 3-Bromo-2-oxopropionic acid;Hexokinase II Inhibitor II, 3-BP - CAS 1113-59-3 - Calbiochem
CAS NO.:1113-59-3
Empirical Formula: C3H3BrO3
Molecular Weight: 166.96
MDL number: MFCD00002587
EINECS: 214-206-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB212.80 | In Stock |
|
| 25G | RMB630.40 | In Stock |
|
| 100G | RMB1878.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-82 °C |
| Boiling point: | 223.4±23.0 °C(Predicted) |
| Density | 1.7314 (rough estimate) |
| refractive index | 1.4650 (estimate) |
| storage temp. | 2-8°C |
| solubility | water: soluble1g/10 mL, clear, colorless |
| pka | 1.84±0.54(Predicted) |
| form | White crystalline solid |
| color | White to Almost white |
| Water Solubility | Soluble in water, dimethyl sulfoxide, ethyl acetate and water. |
| BRN | 1746786 |
| InChI | InChI=1S/C3H3BrO3/c4-1-2(5)3(6)7/h1H2,(H,6,7) |
| InChIKey | PRRZDZJYSJLDBS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(=O)CBr |
| CAS DataBase Reference | 1113-59-3(CAS DataBase Reference) |
| EPA Substance Registry System | Propanoic acid, 3-bromo-2-oxo- (1113-59-3) |
Description and Uses
Bromopyruvic acid is used as an affinity label for cysteine residues and a potential anti-cancer agent. It is involved in the synthesis of imidazo[1,2-a]pyridine-2-carboxylic acids and substituted pyranones. It plays a vital role as a cross-linker between nucleic acids and proteins. It is used as an anticancer agent for lung tumors.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-20/21/22 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | UZ0840000 |
| F | 19-21 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29183000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |




