A1335912
1-Bromo-2,6-dichlorobenzene , 99% , 19393-92-1
CAS NO.：19393-92-1
Empirical Formula: C6H3BrCl2
Molecular Weight: 225.9
MDL number: MFCD00000574
EINECS: 243-018-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB148.00 | In Stock |
|
| 100G | RMB546.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-64 °C (lit.) |
| Boiling point: | 242 °C/765 mmHg (lit.) |
| Density | 1.6351 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| Flash point: | >100°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder and/or Chunks |
| color | White to yellow |
| BRN | 1681054 |
| InChI | InChI=1S/C6H3BrCl2/c7-6-4(8)2-1-3-5(6)9/h1-3H |
| InChIKey | UWOIDOQAQPUVOH-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC(Cl)=C1Br |
| CAS DataBase Reference | 19393-92-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-2,6-dichloro-(19393-92-1) |
Description and Uses
1-Bromo-2,6-dichlorobenzene is used in biological studies to evaluate the toxicity of arylhalides and benzylhalides to Daphnia magna.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-28A |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29039990 |
