A1338912
2-Bromo-6-fluoroaniline , 98% , 65896-11-9
CAS NO.:65896-11-9
Empirical Formula: C6H5BrFN
Molecular Weight: 190.01
MDL number: MFCD01310982
EINECS: 464-930-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB239.20 | In Stock |
|
| 100G | RMB847.20 | In Stock |
|
| 500g | RMB3919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 211.0±20.0 °C(Predicted) |
| Density | 1.674 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 82° |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| pka | 1.15±0.10(Predicted) |
| form | Liquid |
| color | Clear yellow to brown |
| BRN | 8541957 |
| InChI | InChI=1S/C6H5BrFN/c7-4-2-1-3-5(8)6(4)9/h1-3H,9H2 |
| InChIKey | ALZFPYUPNVLVQM-UHFFFAOYSA-N |
| SMILES | C1(N)=C(F)C=CC=C1Br |
| CAS DataBase Reference | 65896-11-9(CAS DataBase Reference) |
Description and Uses
2-BroMo-6-fluoroaniline is used for preparation of cycloalkylated benzothiadiazine derivatives and their use as AMPA receptor modulators.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302-H312-H331 |
| Precautionary statements | P280-P304+P340-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







