A1339112
1-Bromo-4-chloro-2-fluorobenzene , 98% , 1996-29-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB85.60 | In Stock |
|
| 100g | RMB259.20 | In Stock |
|
| 500g | RMB969.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 91-92 °C/20 mmHg (lit.) |
| Density | 1.678 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 198 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Specific Gravity | 1.678 |
| Water Solubility | INSOLUBLE |
| BRN | 2081083 |
| InChI | InChI=1S/C6H3BrClF/c7-5-2-1-4(8)3-6(5)9/h1-3H |
| InChIKey | FPNVMCMDWZNTEU-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(Cl)C=C1F |
| CAS DataBase Reference | 1996-29-8(CAS DataBase Reference) |
Description and Uses
1-Bromo-4-chloro-2-fluorobenzene may be used in the preparation of benzonorbornadiene derivative. It may also be used as a starting material in the multi-step synthesis of AZD3264, an IKK2 (inhibitor of nuclear factor κ-B kinase-2) inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a-P210-P264-P280-P302+P352+P332+P313+P362+P364-P403+P235-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
