A1341212
2-Bromo-4-fluorotoluene , 98% , 1422-53-3
CAS NO.:1422-53-3
Empirical Formula: C7H6BrF
Molecular Weight: 189.02
MDL number: MFCD00040828
EINECS: 215-830-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB35.20 | In Stock |
|
| 100G | RMB96.80 | In Stock |
|
| 500G | RMB416.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 170-172 °C (lit.) |
| Density | 1.526 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 148 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear, faint yellow/faint green |
| Specific Gravity | 1.526 |
| BRN | 1859038 |
| InChI | InChI=1S/C7H6BrF/c1-5-2-3-6(9)4-7(5)8/h2-4H,1H3 |
| InChIKey | SFGFOJPGCOYQJK-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(F)C=C1Br |
| CAS DataBase Reference | 1422-53-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromo-4-fluorotoluene(1422-53-3) |
Description and Uses
2-Bromo-4-fluorotoluene may be used in the preparation of meta-fluoro analog, (tris(5-fluoro-2-methylphenyl)phosphane, F-TOTP).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





