A1341312
2-Bromo-5-fluorotoluene , 98% , 452-63-1
CAS NO.:452-63-1
Empirical Formula: C7H6BrF
Molecular Weight: 189.02
MDL number: MFCD00017921
EINECS: 207-203-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB135.20 | In Stock |
|
| 500G | RMB500.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 177 °C/756 mmHg (lit.) |
| Density | 1.495 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 113 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Difficult to mix. |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.495 |
| Water Solubility | INSOLUBLE |
| BRN | 1859121 |
| InChI | InChI=1S/C7H6BrF/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| InChIKey | RJPNVPITBYXBNB-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(F)C=C1C |
| CAS DataBase Reference | 452-63-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromo-5-fluorotoluene(452-63-1) |
Description and Uses
2-Bromo-5-fluorotoluene is used to produce other chemicals. It can produce 2-Bromo-5-fluoro-benzoic acid. The reaction occurs with reagent KMnO4, solvent H2O and other condition of heating.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39-37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |








