A4331212
4-Fluoro-2-methylbenzonitrile , 97% , 147754-12-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB116.80 | In Stock |
|
| 100G | RMB368.00 | In Stock |
|
| 500g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-74 °C (lit.) |
| Boiling point: | 214.6±20.0 °C(Predicted) |
| Density | 1.11±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8H6FN/c1-6-4-8(9)3-2-7(6)5-10/h2-4H,1H3 |
| InChIKey | BJBXUIUJKPOZLV-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(F)C=C1C |
| CAS DataBase Reference | 147754-12-9(CAS DataBase Reference) |
Description and Uses
As organic intermediate, pharmaceutical intermediate. In chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







