A1342412
1-Bromo-3-(trifluoromethoxy)benzene , 99% , 2252-44-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB32.80 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| 500g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 156-158 °C |
| Density | 1.62 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 145 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.64 |
| BRN | 1945938 |
| InChI | InChI=1S/C7H4BrF3O/c8-5-2-1-3-6(4-5)12-7(9,10)11/h1-4H |
| InChIKey | WVUDHWBCPSXAFN-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(OC(F)(F)F)=C1 |
| CAS DataBase Reference | 2252-44-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-(Trifluoromethoxy)bromobenzene(2252-44-0) |
Description and Uses
1-Bromo-3-(trifluoromethoxy)benzene may be used in the preparation of 1,2-dehydro-3-(trifluoromethoxy)benzene. It may be used in the synthesis of new electronically deficient atropisomeric diphosphine ligand (S)-CF3O-BiPhep [2,2′-bis(diphenylphosphino)-6,6′-ditrifluoromethoxy-1,1′-biphenyl].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H227-H315-H319 |
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501-P210e-P261-P280a-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |






