A1343212
2-Bromo-3-methoxypyridine , 98% , 24100-18-3
CAS NO.：24100-18-3
Empirical Formula: C6H6BrNO
Molecular Weight: 188.02
MDL number: MFCD01570896
EINECS: 246-017-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB142.40 | In Stock |
|
| 25G | RMB481.60 | In Stock |
|
| 100g | RMB1700.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-49 °C (lit.) |
| Boiling point: | 233.4±20.0 °C(Predicted) |
| Density | 1.530±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Dichloromethane |
| pka | -0.51±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to cream |
| InChI | InChI=1S/C6H6BrNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
| InChIKey | PDOWLYNSFYZIQX-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC=C1OC |
| CAS DataBase Reference | 24100-18-3(CAS DataBase Reference) |
Description and Uses
2-BROMO-3-METHOXYPYRIDINE is used in the preparation of triazolopyrimidine derivatives and analogs as AXL receptor tyrosine kinase function inhibitors.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 29333990 |
