A1343312
2-Bromo-3,5-dichloropyridine , 98% , 14482-51-0
CAS NO.：14482-51-0
Empirical Formula: C5H2BrCl2N
Molecular Weight: 226.89
MDL number: MFCD00233990
EINECS: 672-535-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB140.00 | In Stock |
|
| 100G | RMB458.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-42 |
| Boiling point: | 243.3±35.0 °C(Predicted) |
| Density | 1.848±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -2.37±0.10(Predicted) |
| form | Solid |
| color | Pale brown |
| InChI | InChI=1S/C5H2BrCl2N/c6-5-4(8)1-3(7)2-9-5/h1-2H |
| InChIKey | QCKPJWDIDCGQRB-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 14482-51-0(CAS DataBase Reference) |
Description and Uses
2-Bromo-3,5-dichloropyridine is used in various fields, including pharmaceuticals, agrochemicals, and materials science. It is an essential intermediate for the synthesis of different chemical compounds, such as fungicides, herbicides, and insecticides.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-41-37/38-25 |
| Safety Statements | 26-45-39 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
