A1344212
2-Bromo-5-fluorophenol , 97% , 147460-41-1
CAS NO.：147460-41-1
Empirical Formula: C6H4BrFO
Molecular Weight: 191
MDL number: MFCD00040939
EINECS: 604-585-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB237.60 | In Stock |
|
| 100G | RMB839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 185°C |
| Density | 1.717 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 189 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 7.43±0.10(Predicted) |
| Specific Gravity | 1.717 |
| color | Clear colorless to light yellow |
| BRN | 7915214 |
| InChI | InChI=1S/C6H4BrFO/c7-5-2-1-4(8)3-6(5)9/h1-3,9H |
| InChIKey | HUVAOAVBKOVPBZ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=CC=C1Br |
| CAS DataBase Reference | 147460-41-1(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-fluorophenol may be used for the preparation of reaction intermediates required for the synthesis of polycyclic 5-HT3 and 5-HT4 antagonists. It may be used for the the nucleophilic substitution of the 2,2′,4,4′-tetrabromodiphenyl iodonium chloride (iodyl salt).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29071990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
