A1344612
(-)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane , 97% , 93379-48-7
Synonym(s):
(−)-trans-α,α′-(2,2-Dimethyl-1,3-dioxolane-4,5-diyl)bis(diphenylmethanol);(−)-2,3-O-Isopropylidene-1,1,4,4-tetraphenyl-L -threitol;(4R,5R)-4,5-Bis(diphenylhydroxymethyl)-2,2-dimethyldioxolane;1,1,4,4-Tetraphenyl-2,3-O-isopropylidene-L -threitol;TADDOL
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.00 | In Stock |
|
| 5G | RMB177.60 | In Stock |
|
| 25G | RMB766.40 | In Stock |
|
| 100g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-195 °C(lit.) |
| alpha | -65.5 º (c=1, CHCl3) |
| Boiling point: | 489.39°C (rough estimate) |
| Density | 1.0864 (rough estimate) |
| refractive index | -69 ° (C=1, CHCl3) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| pka | 12.28±0.29(Predicted) |
| color | white |
| optical activity | [α]19/D 62.6°, c = 1 in chloroform |
| BRN | 3657855 |
| InChIKey | RNSJHECWLNVNFE-KYJUHHDHSA-N |
| SMILES | C(C1C=CC=CC=1)(C1C=CC=CC=1)([C@@H]1OC(C)(C)O[C@H]1C(C1C=CC=CC=1)(C1C=CC=CC=1)O)O |&1:13,19,r| |
| CAS DataBase Reference | 93379-48-7(CAS DataBase Reference) |
Description and Uses
Hydrogen-bonding organocatalyst examined in terms of acidity, deprotonation enthalpies and hydrogen bonding
Catalyst involved in synthesis of cyclopropylamines via addition reactions of Grignard reagents to amides
Reactant or reagent involved in:
- Enantioswitching of catalytic asymmetric hydroboration
- Synthesis of derivative ligands for asymmetric hydroformylation of alkenes
- Amide-directed catalytic asymmetric hydroboration of trisubstituted alkenes
- Addition of deactivated alkyl Grignard reagents to aldehydes
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/38-36/37/38-20/21/22 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29329970 |
| Storage Class | 11 - Combustible Solids |

![(-)-4,5-Bis[hydroxy(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolane](https://img.chemicalbook.com/CAS/GIF/93379-48-7.gif)

