A1345112
N-Benzylquininium Chloride [Chiral Phase-Transfer Catalyst] , 95% , 67174-25-8
Synonym(s):
QUIBEC
CAS NO.:67174-25-8
Empirical Formula: C27H31ClN2O2
Molecular Weight: 451
MDL number: MFCD00198105
EINECS: 224-828-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB183.20 | In Stock |
|
| 5G | RMB639.20 | In Stock |
|
| 25g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200-205 °C (dec.) (lit.) |
| refractive index | 227.5 ° (C=1.5, H2O) |
| storage temp. | 2-8°C |
| solubility | freely sol H2O, alcohols, acetone; slightly sol EtOAc; sparingly sol CHCl3 |
| form | powder to crystal |
| color | White to Light yellow |
| optical activity | [α]20/D 235°, c = 1.5 in H2O |
| BRN | 5702637 |
| InChIKey | JYDIJFKNXHPWBJ-GOGFHWEMSA-M |
| SMILES | [Cl-].COc1ccc2nccc([C@@H](O)[C@@H]3C[C@@H]4CC[N@+]3(C[C@@H]4C=C)Cc5ccccc5)c2c1 |
| CAS DataBase Reference | 67174-25-8 |
Description and Uses
N-Benzylquininium chloride can be used as a phase transfer catalyst:
- In the sulfenylation of various β-keto sulfoxides.
- To synthesize N-carbamoyl-protected β-nitroamines from α-amido sulfones by asymmetric aza-Henry reaction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |

![N-Benzylquininium Chloride [Chiral Phase-Transfer Catalyst]](https://img.chemicalbook.com/CAS/GIF/67174-25-8.gif)




