A1345712
3-Bromo-4-methylbenzonitrile , 97% , 42872-74-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB138.40 | In Stock |
|
| 100g | RMB468.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-45 °C (lit.) |
| Boiling point: | 259.1±20.0 °C(Predicted) |
| Density | 1.51±0.1 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | fused solid |
| Appearance | White to off-white Solid |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C8H6BrN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
| InChIKey | VXUMRYMTYKDWMO-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C)C(Br)=C1 |
| CAS DataBase Reference | 42872-74-2(CAS DataBase Reference) |
Description and Uses
Used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |





