A1350050
3-t-ButyldimethylsilanyloxyPropionaldehyde , 95% , 89922-82-7
Synonym(s):
3-(tert-Butyl-dimethylsilanyloxy)propionaldehyde;3-[(tert-Butyldimethylsilyl)oxy]-1-propanal;3-[(tert-Butyldimethylsilyl)oxy]propionaldehyde;;3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]propanal;3-[Dimethyl(1,1-dimethylethyl)siloxy]propanal
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB128.00 | In Stock |
|
| 250mg | RMB159.20 | In Stock |
|
| 1g | RMB484.80 | In Stock |
|
| 5g | RMB2014.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 95 °C(Press: 23 Torr) |
| Density | 0.892 g/mL at 25 °C |
| refractive index | n20/D1.431 |
| Flash point: | 84℃ |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| InChI | InChI=1S/C9H20O2Si/c1-9(2,3)12(4,5)11-8-6-7-10/h7H,6,8H2,1-5H3 |
| InChIKey | WGWCJTNWUFFGFH-UHFFFAOYSA-N |
| SMILES | C(=O)CCO[Si](C(C)(C)C)(C)C |
Description and Uses
3-[(tert-Butyldimethylsilyl)oxy]-1-propanal is useful for preparing EGFR inhibitors for the treatment of cancer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | WGK 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Excepted Quantities | Non-Hazardous |







