BD1316432
3-(tert-Butyldimethylsilyloxy)glutaric anhydride , 98% , 91424-40-7
CAS NO.：91424-40-7
Empirical Formula: C11H20O4Si
Molecular Weight: 244.36
MDL number: MFCD00075235
EINECS: 618-749-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB104.80 | In Stock |
|
| 5g | RMB364.00 | In Stock |
|
| 25g | RMB1535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-81 °C(lit.) |
| Boiling point: | 302.4±35.0 °C(Predicted) |
| Density | 1.030 |
| Flash point: | >113°(235°F) |
| refractive index | 1.4510 |
| storage temp. | 2-8°C |
| form | Solid |
| Appearance | White to off-white Solid |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C11H20O4Si/c1-11(2,3)16(4,5)15-8-6-9(12)14-10(13)7-8/h8H,6-7H2,1-5H3 |
| InChIKey | RXAJGRHLLRGVSB-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)CC(O[Si](C(C)(C)C)(C)C)C1 |
| CAS DataBase Reference | 91424-40-7(CAS DataBase Reference) |
Description and Uses
3-(tert-Butyldimethylsilyloxy)glutaric anhydride was employed as starting material for the preparation of labeling reagents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
