A5445112
Methyl 4-tert-butylbenzoate , 99% , 26537-19-9
CAS NO.:26537-19-9
Empirical Formula: C12H16O2
Molecular Weight: 192.25
MDL number: MFCD00008835
EINECS: 247-768-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB36.80 | In Stock |
|
| 100g | RMB65.60 | In Stock |
|
| 500g | RMB226.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 122-124 °C9 mm Hg(lit.) |
| Density | 0.995 g/mL at 25 °C(lit.) |
| vapor pressure | 1.36hPa at 20℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 0.995 |
| color | Clear colorless to yellow |
| Water Solubility | 35mg/L at 20℃ |
| Cosmetics Ingredients Functions | FRAGRANCE PERFUMING FLAVOURING |
| InChI | 1S/C12H16O2/c1-12(2,3)10-7-5-9(6-8-10)11(13)14-4/h5-8H,1-4H3 |
| InChIKey | UPIJOAFHOIWPLT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(cc1)C(C)(C)C |
| LogP | 4.3 at 25℃ |
| CAS DataBase Reference | 26537-19-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Tert-butylbenzoic acid methyl ester(26537-19-9) |
| EPA Substance Registry System | Benzoic acid, 4-(1,1-dimethylethyl)-, methyl ester (26537-19-9) |
Description and Uses
Methyl 4-tert-butylbenzoate was used in the synthesis of tris(4-tert-butylphenyl)methyl chloride.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P280-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29163990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |



