A1351612
Bis(4-tert-butylphenyl)amine , 90% , 4627-22-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB395.20 | In Stock |
|
| 500g | RMB1224.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 108 °C |
| Boiling point: | 195 °C / 3mmHg |
| Density | 0.974±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 1.47±0.40(Predicted) |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C20H27N/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6/h7-14,21H,1-6H3 |
| InChIKey | OPEKHRGERHDLRK-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=C(C(C)(C)C)C=C2)=CC=C(C(C)(C)C)C=C1 |
Description and Uses
Bis(4-tert-butylphenyl)amine could be a useful reagent for synthesizing efficient luminogens with AIE features that permit imaging the brain through an intact skull.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| HS Code | 29214990 |
