A1353850
SSR128129E , 98% , 848318-25-2
CAS NO.:848318-25-2
Empirical Formula: C18H15N2NaO4
Molecular Weight: 346.312
MDL number: MFCD25976751
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB404.80 | In Stock |
|
| 10mg | RMB895.20 | In Stock |
|
| 25mg | RMB1359.20 | In Stock |
|
| 50mg | RMB2399.20 | In Stock |
|
| 100mg | RMB4319.20 | In Stock |
|
| 250mg | RMB9719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >230°C (dec.) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Yellow |
| Stability: | Hygroscopic |
| InChI | 1S/C18H16N2O4.Na/c1-10-15(20-8-4-3-5-14(20)17(10)24-2)16(21)11-6-7-13(19)12(9-11)18(22)23;/h3-9H,19H2,1-2H3,(H,22,23);/q;+1/p-1 |
| InChIKey | JFBMSTWZURKQOC-UHFFFAOYSA-M |
| SMILES | [Na+].[n]21c(c(c(c2C(=O)c3cc(c(cc3)N)C(=O)[O-])C)OC)cccc1 |
Description and Uses
SSR128129E (SSR) is an potent FGFR inhibitor, which inhibits fibroblast growth factor receptor (FGFR). Oral delivery of SSR128129E inhibits arthritis and tumors that are relatively refractory to anti-vascular endothelial growth factor receptor-2 antibodies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |






