A1354312
(R)-1-Boc-3-hydroxypiperidine , 97% , 143900-43-0
Synonym(s):
(R)-tert-Butyl 3-hydroxypiperidine-1-carboxylate
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB36.00 | In Stock |
|
| 25g | RMB159.20 | In Stock |
|
| 100g | RMB479.20 | In Stock |
|
| 500g | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-50 °C |
| Boiling point: | 292.3±33.0 °C(Predicted) |
| Density | 1.107±0.06 g/cm3(Predicted) |
| Flash point: | 104°C |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | Low Melting Solid |
| pka | 14.74±0.20(Predicted) |
| color | White to tan |
| optical activity | [α]/D 22±3°, c = 5 in methanol |
| InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-6-4-5-8(12)7-11/h8,12H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | UIJXHKXIOCDSEB-MRVPVSSYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H](O)C1 |
| CAS DataBase Reference | 143900-43-0(CAS DataBase Reference) |
Description and Uses
(R)-1-Boc-3-hydroxypiperidine has been used as a reactant for the synthesis of piperidinyl and pyrrolidinyl butyrates. It has also been used for the synthesis of constrained (-)-S-adenosyl-L-homocysteine (SAH) analogs as DNA methyltransferase inhibitors.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | T |
| Risk Statements | 36/37/38-41-37/38-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
![(R)-tert-Butyl 3-(4-amino-3-(4-phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl)piperidine-1-carboxylate](https://img.chemicalbook.com/CAS/20150408/GIF/1022150-11-3.gif)
