A1355112
(S)-N-BOC-Piperidine-2-carboxylic acid , 98% , 26250-84-0
Synonym(s):
(S)-(−)-1-(tert-Butoxycarbonyl)-2-piperidinecarboxylic acid;(S)-1-Boc-piperidine-2-carboxylic acid;N-Boc-L -pipecolinic acid
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB142.40 | In Stock |
|
| 100G | RMB558.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-126 °C(lit.) |
| alpha | -63.2 º (c=1 in acetic acid) |
| Boiling point: | 353.2±35.0 °C(Predicted) |
| Density | 1.164±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform, Methanol |
| form | Powder |
| pka | 4.03±0.20(Predicted) |
| color | White to off-white |
| optical activity | [α]23/D 63.2°, c = 1 in acetic acid |
| Water Solubility | Insoluble in water. |
| BRN | 3652038 |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(15)12-7-5-4-6-8(12)9(13)14/h8H,4-7H2,1-3H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | JQAOHGMPAAWWQO-QMMMGPOBSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCC[C@H]1C(O)=O |
| CAS DataBase Reference | 26250-84-0(CAS DataBase Reference) |
Description and Uses
(S)-1-Boc-piperidine-2-carboxylic acid is an N-substituted derivative of Pipecolinic acid useful in modulating ion channel activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
