A8457312
N-Carbobenzyloxyglycine , 98% , 1138-80-3
Synonym(s):
Z-Glycine
CAS NO.:1138-80-3
Empirical Formula: C10H11NO4
Molecular Weight: 209.2
MDL number: MFCD00002691
EINECS: 214-516-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB42.40 | In Stock |
|
| 100G | RMB97.60 | In Stock |
|
| 250g | RMB231.20 | In Stock |
|
| 500G | RMB394.40 | In Stock |
|
| 2.5kg | RMB1814.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-122 °C(lit.) |
| Boiling point: | 348.55°C (rough estimate) |
| Density | 1.2944 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear |
| form | Fine Crystalline Powder |
| pka | 3.98±0.10(Predicted) |
| color | White |
| Water Solubility | Soluble in methanol. Insoluble in water. |
| BRN | 526877 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H11NO4/c12-9(13)6-11-10(14)15-7-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,14)(H,12,13) |
| InChIKey | CJUMAFVKTCBCJK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CNC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 1138-80-3(CAS DataBase Reference) |
| EPA Substance Registry System | Glycine, N-[(phenylmethoxy)carbonyl]- (1138-80-3) |
Description and Uses
N-Carbobenzoxyglycine is used in the dipeptide synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 62-36/37/38-20/21/22 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| RTECS | MB9129000 |
| TSCA | TSCA listed |
| HS Code | 29242995 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,intravaginal,380mg/kg (380mg/kg),Journal of Pharmaceutical Sciences. Vol. 68, Pg. 696, 1979. |







