A8454112
Z-Pro-OH , 98% , 1148-11-4
Synonym(s):
Z-L -Proline
CAS NO.:1148-11-4
Empirical Formula: C13H15NO4
Molecular Weight: 249.26
MDL number: MFCD00003170
EINECS: 214-557-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB40.00 | In Stock |
|
| 50g | RMB79.20 | In Stock |
|
| 100G | RMB128.00 | In Stock |
|
| 500G | RMB468.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-77 °C |
| alpha | -60 º (c=2,AcOH) |
| Boiling point: | 392.36°C (rough estimate) |
| Density | 1.1952 (rough estimate) |
| refractive index | -40 ° (C=2, EtOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility in methanol, almost transparency. |
| pka | 3.99±0.20(Predicted) |
| form | Crystalline Powder or Crystals |
| color | White to off-white |
| optical activity | [α]20/D 42°, c = 2 in ethanol |
| BRN | 88579 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13H15NO4/c15-12(16)11-7-4-8-14(11)13(17)18-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H,15,16)/t11-/m0/s1 |
| InChIKey | JXGVXCZADZNAMJ-NSHDSACASA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)CCC[C@H]1C(O)=O |
| CAS DataBase Reference | 1148-11-4(CAS DataBase Reference) |
Description and Uses
N-(Benzyloxycarbonyl)-L-proline is a potent in vitro and in vivo inhibitor of prolidase; a specific peptidase that cleaves dipeptides with a C-terminal prolyl and hydroxylprolyl residue. It is also used in the synthesis of N-(L-Prolyl)-β-alanine which is a derivative of the naturally occurring beta amino acid β-Alanine.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 62-36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | UY0745000 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |







