A8463512
                    Z-Ser-OH , 98% , 1145-80-8
                            Synonym(s):
Carbobenzyloxy-L -serine;Z-L -Serine
                            
                        
                CAS NO.:1145-80-8
Empirical Formula: C11H13NO5
Molecular Weight: 239.22
MDL number: MFCD00002662
EINECS: 214-546-4
| Pack Size | Price | Stock | Quantity | 
| 5G | RMB23.20 | In Stock | 
                                                 | 
                                        
| 25G | RMB53.60 | In Stock | 
                                                 | 
                                        
| 100g | RMB158.40 | In Stock | 
                                                 | 
                                        
| 500g | RMB639.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 116-119 °C(lit.) | 
                                    
| Boiling point: | 381.88°C (rough estimate) | 
                                    
| alpha | 6 º (c=7, AcOH) | 
                                    
| Density | 1.2967 (rough estimate) | 
                                    
| refractive index | 6.1 ° (C=6, AcOH) | 
                                    
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature | 
                                    
| solubility | Acetic Acid (Sparingly), DMSO | 
                                    
| pka | 3.60±0.10(Predicted) | 
                                    
| form | Powder | 
                                    
| color | White to cream | 
                                    
| optical activity | [α]20/D +5.8°, c = 2.7 in acetic acid | 
                                    
| BRN | 2058314 | 
                                    
| InChI | InChI=1S/C11H13NO5/c13-6-9(10(14)15)12-11(16)17-7-8-4-2-1-3-5-8/h1-5,9,13H,6-7H2,(H,12,16)(H,14,15)/t9-/m0/s1 | 
                                    
| InChIKey | GNIDSOFZAKMQAO-VIFPVBQESA-N | 
                                    
| SMILES | C(O)(=O)[C@H](CO)NC(OCC1=CC=CC=C1)=O | 
                                    
| CAS DataBase Reference | 1145-80-8(CAS DataBase Reference) | 
                                    
Description and Uses
Building block in peptide synthesis; Starting material for the synthesis of various α-amino acids via the β-lactone
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07  | 
                                    
| Signal word | Danger | 
| Hazard statements | H302-H314 | 
| Precautionary statements | P501-P260-P270-P264-P280-P303+P361+P353-P301+P330+P331-P363-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P405 | 
| Hazard Codes | Xn | 
| Risk Statements | 20/21/22-36/37/38 | 
| Safety Statements | 24/25-36-26 | 
| WGK Germany | 3 | 
| HS Code | 29242990 | 








