A6333212
<i>N</i>-Carbobenzoxy-<small>L</small>-serine Benzyl Ester , >97.0%(HPLC) , 21209-51-8
Synonym(s):
N-Cbz-L -serine benzyl ester
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB118.40 | In Stock |
|
| 25G | RMB426.40 | In Stock |
|
| 100g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-86 °C(lit.) |
| Boiling point: | 534.5±50.0 °C(Predicted) |
| Density | 1.253 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform, Methanol |
| pka | 10.46±0.46(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| optical activity | [α]20/D +5°, c = 1 in chloroform |
| Water Solubility | Slightly soluble in water. |
| Major Application | peptide synthesis |
| InChI | 1S/C18H19NO5/c20-11-16(17(21)23-12-14-7-3-1-4-8-14)19-18(22)24-13-15-9-5-2-6-10-15/h1-10,16,20H,11-13H2,(H,19,22)/t16-/m0/s1 |
| InChIKey | MHHDPGHZHFJLBZ-INIZCTEOSA-N |
| SMILES | OC[C@H](NC(=O)OCc1ccccc1)C(=O)OCc2ccccc2 |
| CAS DataBase Reference | 21209-51-8(CAS DataBase Reference) |
Description and Uses
N-Benzyloxycarbonyl-L-serine benzyl ester is used as a building block in peptide synthesis and as a biochemical reagent. It is also used to synthesize the corresponding N-benzyloxycarbonyl-O-tert-butyl-(lor dl)-serine benzyl ester. Further, it serves as a pharmaceutical intermediate.







