A2364312
N-Carbobenzoxy-L-glutamic Acid , 98% , 1155-62-0
Synonym(s):
N-(Carbobenzyloxy)-L -glutamic acid;Z-L -Glutamic acid
CAS NO.：1155-62-0
Empirical Formula: C13H15NO6
Molecular Weight: 281.26
MDL number: MFCD00002801
EINECS: 214-584-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB18.40 | In Stock |
|
| 10g | RMB23.20 | In Stock |
|
| 25G | RMB29.60 | In Stock |
|
| 100G | RMB101.60 | In Stock |
|
| 500g | RMB439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-117 °C(lit.) |
| alpha | -7.4 º (c=10, CH3COOH 22 ºC) |
| Boiling point: | 423.93°C (rough estimate) |
| Density | 1.2801 (rough estimate) |
| refractive index | -7.5 ° (C=8, AcOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF, Methanol |
| form | Solid |
| pka | 3.81±0.10(Predicted) |
| color | Off-White |
| optical activity | [α]22/D 7.4°, c = 10 in acetic acid |
| BRN | 2061272 |
| InChI | InChI=1S/C13H15NO6/c15-11(16)7-6-10(12(17)18)14-13(19)20-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,19)(H,15,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | PVFCXMDXBIEMQG-JTQLQIEISA-N |
| SMILES | C(O)(=O)[C@H](CCC(O)=O)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 1155-62-0(CAS DataBase Reference) |
| EPA Substance Registry System | L-Glutamic acid, N-[(phenylmethoxy)carbonyl]- (1155-62-0) |
Description and Uses
N-Cbz-L-glutamic acid is used for the synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
