A8450612
Z-Thr-OH , 98% , 19728-63-3
Synonym(s):
N-Carbobenzyloxy-L -threonine;N-Cbz-L -threonine;Z-L -Threonine
CAS NO.:19728-63-3
Empirical Formula: C12H15NO5
Molecular Weight: 253.25
MDL number: MFCD00065948
EINECS: 243-258-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB77.04 | In Stock |
|
| 25G | RMB112.80 | In Stock |
|
| 10g | RMB115.20 | In Stock |
|
| 100G | RMB543.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-103 °C(lit.) |
| alpha | -4.7 º (c=4, acetic acid) |
| Boiling point: | 396.45°C (rough estimate) |
| Density | 1.2499 (rough estimate) |
| refractive index | -4.9 ° (C=2, AcOH) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | almost transparency[in Methanol] |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 3.58±0.10(Predicted) |
| color | White to Almost white |
| optical activity | -7.733° (C=1.00 g/100ml, ACOH) |
| BRN | 2335409 |
| Major Application | peptide synthesis |
| InChI | 1S/C12H15NO5/c1-8(14)10(11(15)16)13-12(17)18-7-9-5-3-2-4-6-9/h2-6,8,10,14H,7H2,1H3,(H,13,17)(H,15,16)/t8-,10+/m1/s1 |
| InChIKey | IPJUIRDNBFZGQN-SCZZXKLOSA-N |
| SMILES | C[C@@H](O)[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 19728-63-3(CAS DataBase Reference) |
Description and Uses
N-Cbz-L-threonine is an N-Cbz-protected form of L-Threonine (T405500). L-Threonine is an essential amino acid that is commonly used as a feed and food additive. L-Threonine is produced in mass quantities by mutant Escherichia coli strains for research and food nutrition purposes. L-Threonine can be naturally found in fish and poultry, and is incorporated in some important proteins in the human body (such as hemoglobin and insulin).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |







