A1355312
N-Boc-piperidine-2-methanol , 97% , 157634-00-9
Synonym(s):
N-Boc-2-(hydroxymethyl)piperidine;2-Hydroxymethylpiperidine-1-carboxylic acid tert-butyl ester
CAS NO.：157634-00-9
Empirical Formula: C11H21NO3
Molecular Weight: 215.29
MDL number: MFCD04114966
EINECS: 627-195-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB51.20 | In Stock |
|
| 25G | RMB156.80 | In Stock |
|
| 100G | RMB415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 74-78 °C |
| Boiling point: | 308.0±15.0 °C(Predicted) |
| Density | 1.059±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| pka | 15.08±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| InChI | InChI=1S/C11H21NO3/c1-11(2,3)15-10(14)12-7-5-4-6-9(12)8-13/h9,13H,4-8H2,1-3H3 |
| InChIKey | PZTAGFCBNDBBFZ-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCCC1CO |
| CAS DataBase Reference | 157634-00-9(CAS DataBase Reference) |
Description and Uses
Reactant for:
- Julia coupling for synthesis of corydendramine A
- Cyclization-functionalization of nitrogen-containing dienes
Reactant for synthesis of:
- Heterocyclic compounds
- Anthranilamide inhibitors of factor Xa
- Human GnRH receptor antagonists
- Sphingosine-1-phosphate receptor agonists
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P301+P310-P305+P351+P338-P280a-P301+P310a-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HazardClass | 6.1 |
| HS Code | 29333990 |
