LN5972548
Analysis standard reagent , 10453-86-8
CAS NO.：10453-86-8
Empirical Formula: C22H26O3
Molecular Weight: 338.44
MDL number: MFCD00041806
EINECS: 233-940-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB214.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56.5℃ |
| Boiling point: | bp >180° (dec) |
| Density | 0.96 g/cm3 |
| vapor pressure | ﹤l×10-5 Pa (25 °C) |
| refractive index | 1.5287 (20℃) |
| Flash point: | closed cup: 264.2°F (129°C) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| Water Solubility | 0.038 mg l-1 (25 °C) |
| BRN | 1626510 |
| Major Application | agriculture environmental |
| Cosmetics Ingredients Functions | ANTIMICROBIAL |
| InChI | 1S/C22H26O3/c1-15(2)10-19-20(22(19,3)4)21(23)25-14-17-12-18(24-13-17)11-16-8-6-5-7-9-16/h5-10,12-13,19-20H,11,14H2,1-4H3 |
| InChIKey | VEMKTZHHVJILDY-UHFFFAOYSA-N |
| SMILES | C\C(C)=C\C1C(C(=O)OCc2coc(Cc3ccccc3)c2)C1(C)C |
| EPA Substance Registry System | Resmethrin (10453-86-8) |
Description and Uses
Resmethrin is used to control a wide range of insects in horticultural, household, public health and animal health situations. It has some agricultural use but this is limited. The more active 1Rtrans form has a similar range of uses and is also used in stored grain products.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60/61-61-60 |
| RIDADR | 3082 |
| WGK Germany | 3 |
| RTECS | GZ1310000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 10453-86-8(Hazardous Substances Data) |
| Toxicity | LC50 (96 hr) in rainbow trout, bluegill sunfish (mg/l): 3.14, 7.2 (Rand) |
