A1356212
2-(Boc-oxyimino)-2-phenylacetonitrile , 99% , 58632-95-4
Synonym(s):
2-(tert-Butoxycarbonyloxyimino)-2-phenyl-acetonitrile;Boc-ON
CAS NO.:58632-95-4
Empirical Formula: C13H14N2O3
Molecular Weight: 246.26
MDL number: MFCD00001863
EINECS: 261-370-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB88.80 | In Stock |
|
| 100G | RMB355.20 | In Stock |
|
| 500g | RMB1609.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-88 °C (lit.) |
| Boiling point: | 389.26°C (rough estimate) |
| Density | 1.1855 (rough estimate) |
| refractive index | 1.6450 (estimate) |
| storage temp. | -20°C |
| solubility | Soluble in water or 1% acetic acid |
| form | Fine Crystalline Powder |
| color | White to slightly beige |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| BRN | 2217296 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13H14N2O3/c1-13(2,3)17-12(16)18-15-11(9-14)10-7-5-4-6-8-10/h4-8H,1-3H3 |
| InChIKey | QQWYQAQQADNEIC-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)ON=C(C#N)C1=CC=CC=C1 |
| CAS DataBase Reference | 58632-95-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzeneacetonitrile, .alpha.-[[[(1,1-dimethylethoxy)carbonyl]oxy]imino]- (58632-95-4) |
Description and Uses
Widely used for protection of amino groups in peptide synthesis and multi-step organic synthesis of small molecules.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H302-H312-H332-H335 |
| Precautionary statements | P264-P270-P280-P301+P310+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P405-P501-P261-P304+P340-P305+P351+P338-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36/37/39-26-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| RTECS | DA0513600 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29280090 |
| Storage Class | 11 - Combustible Solids |






