A1358112
1-Benzyl-3-hydroxypyrrolidine , 96% , 775-15-5
Synonym(s):
1-Benzyl-3-hydroxypyrrolidine
CAS NO.:775-15-5
Empirical Formula: C11H15NO
Molecular Weight: 177.24
MDL number: MFCD00012132
EINECS: 212-273-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB135.20 | In Stock |
|
| 25G | RMB503.20 | In Stock |
|
| 100g | RMB1615.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 113-115 °C2 mm Hg(lit.) |
| Density | 1.07 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 14.82±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| BRN | 6039 |
| InChI | InChI=1S/C11H15NO/c13-11-6-7-12(9-11)8-10-4-2-1-3-5-10/h1-5,11,13H,6-9H2 |
| InChIKey | YQMXOIAIYXXXEE-UHFFFAOYSA-N |
| SMILES | N1(CC2=CC=CC=C2)CCC(O)C1 |
| CAS DataBase Reference | 775-15-5(CAS DataBase Reference) |
Description and Uses
1-Benzyl-3-pyrrolidinol was used in preparation of:
- potent calcium antagonist, 1-benzyl-3-pyrrolidinyl methyl 2,6-dimethyl-4-(m-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate
- (3R)-1-benzyl-3-methanesulfonyloxy pyrrolidine
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 1 |
| F | 10-34 |
| HazardClass | 6.1 |
| HS Code | 29339900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






