A1358212
(R)-1-Boc-3-cyanopyrrolidine , 96% , 132945-76-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB237.60 | In Stock |
|
| 1G | RMB406.80 | In Stock |
|
| 5g | RMB767.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 307.9±35.0 °C(Predicted) |
| Density | 1.08±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | -3.73±0.40(Predicted) |
| Appearance | white solid |
| optical activity | [α]/D -21.0±2.0°, c = 1 in methanol |
| BRN | 8683216 |
| InChI | 1S/C10H16N2O2/c1-10(2,3)14-9(13)12-5-4-8(6-11)7-12/h8H,4-5,7H2,1-3H3/t8-/m0/s1 |
| InChIKey | VDDMCMFPUSCJNA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)C#N |
| CAS DataBase Reference | 132945-76-7(CAS DataBase Reference) |
Description and Uses
(R)-1-Boc-3-cyanopyrrolidine is used in the preparation of 1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic Acid compounds as anti-microbial agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





