A1360612
4-Bromophenyl methyl sulfone , 98% , 3466-32-8
Synonym(s):
1-Bromo-4-(methylsulfonyl)benzene
CAS NO.:3466-32-8
Empirical Formula: C7H7BrO2S
Molecular Weight: 235.1
MDL number: MFCD00025065
EINECS: 222-421-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB143.20 | In Stock |
|
| 25G | RMB575.20 | In Stock |
|
| 50g | RMB999.20 | In Stock |
|
| 100G | RMB1839.20 | In Stock |
|
| 250g | RMB3679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103-107 °C (lit.) |
| Boiling point: | 348.6±34.0 °C(Predicted) |
| Density | 1.595±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| solubility | soluble in Methanol |
| form | Crystals or Crystalline Powder |
| color | White |
| BRN | 2045675 |
| InChI | InChI=1S/C7H7BrO2S/c1-11(9,10)7-4-2-6(8)3-5-7/h2-5H,1H3 |
| InChIKey | FJLFSYRGFJDJMQ-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(S(C)(=O)=O)C=C1 |
| CAS DataBase Reference | 3466-32-8(CAS DataBase Reference) |
Description and Uses
4-Bromophenyl methyl sulfone may be used to synthesize:
- biaryl methyl sulfones
- 5-[[-4-(methylsulfonyl)phenyl]thio]thiophene-2-sulfonamide
- 1-[4-(methylsulfonyl)phenyl]-1H-pyrazole (Hmsppz)
- DuP 697 via reaction with (5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)trimethylsilane
4-Bromophenyl methyl sulfone (1-bromo-4-(methylsulfonyl)benzene) can undergo coupling reaction with benzene sulfonamide in the presence of copper(I)iodide to form the corresponding N-aryl sulfonamide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-24/25-36/37/39-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |




