(+)-Biotin hydrazide , 98% , 66640-86-6
CAS NO.:66640-86-6
Empirical Formula: C10H18N4O2S
Molecular Weight: 258.34
MDL number: MFCD00078532
EINECS: 613-970-0
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB110.40 | In Stock |
|
| 100MG | RMB360.00 | In Stock |
|
| 500MG | RMB1599.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 245-247 °C |
| Boiling point: | 633.1±40.0 °C(Predicted) |
| Density | 1.243±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≤20 mg/mL |
| pka | 13.25±0.35(Predicted) |
| form | powder |
| color | White to Almost white |
| BRN | 28347 |
| InChI | InChI=1S/C10H18N4O2S/c11-14-8(15)4-2-1-3-7-9-6(5-17-7)12-10(16)13-9/h6-7,9H,1-5,11H2,(H,14,15)(H2,12,13,16)/t6-,7-,9-/m0/s1 |
| InChIKey | KOZWHQPRAOJMBN-ZKWXMUAHSA-N |
| SMILES | C1(=O)N[C@]2([H])[C@H](CCCCC(NN)=O)SC[C@]2([H])N1 |
| CAS DataBase Reference | 66640-86-6(CAS DataBase Reference) |
Description and Uses
Biotin hydrazide is a biotinyl derivative used to label surface functional groups, antibodies, lectins, sugars, nucleic acids, or molecules with free carboxylic or keto groups. Biotin hydrazide is used as a probe for determining protein carbonylation, an irreversible posttranslational modification resulting from the actions of reactive oxygen species or lipid oxidation products. The reaction of this probe is direct and does not require catalysts or reducing agents.
Biotin Hydrazide is a carbohydrate reactive biotinylation reagent used predominately for labeling monoclonal antibodies, unpaired cytosine residues in nucleic acids and glycoproteins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29349990 |




![4-Nitrophenyl5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanoate](https://img.chemicalbook.com/CAS/GIF/33755-53-2.gif)
