A3272612
Dansylhydrazine , ≥95%(HPLC) , 33008-06-9
Synonym(s):
5-(Dimethylamino)-1-naphthalenesulfonic hydrazide;5-(Dimethylamino)naphthalene-1-sulfono-hydra-zide;Dns-Hz
CAS NO.:33008-06-9
Empirical Formula: C12H15N3O2S
Molecular Weight: 265.33
MDL number: MFCD00003986
EINECS: 251-337-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB101.60 | In Stock |
|
| 1G | RMB299.20 | In Stock |
|
| 5G | RMB1107.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-130 °C (lit.) |
| Boiling point: | 450.8±37.0 °C(Predicted) |
| Density | 1.331±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | ethanol: soluble |
| pka | 9.31±0.40(Predicted) |
| form | Solid |
| color | Pale Yellow to Pale Green |
| Sensitive | Moisture Sensitive |
| BRN | 2868662 |
| InChI | 1S/C12H15N3O2S/c1-15(2)11-7-3-6-10-9(11)5-4-8-12(10)18(16,17)14-13/h3-8,14H,13H2,1-2H3 |
| InChIKey | KPQYDVAFRDWIBW-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(cccc12)S(=O)(=O)NN |
| CAS DataBase Reference | 33008-06-9(CAS DataBase Reference) |
Description and Uses
Dansylhydrazine can exhibit fluorescence, which can be used for the following:
- monitoring air pollution by detection of the hydrazones formed by acid-catalyzed derivatization of the carbonyl compounds
- detection of the separated glycoproteins via sodium dodecyl sulfate polyacrylamide gel electrophoresis(SDS-PAGE)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 32049010 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![Dansylamide [for Fluorometry]](https://img.chemicalbook.com/CAS/GIF/1431-39-6.gif)