F496829
1-Thionaphthol , 99 , 529-36-2
Synonym(s):
α-Naphthalenethiol;1-Mercaptonaphthalene;1-Naphthylthiol;Naphthalene-1-thiol
CAS NO.:529-36-2
Empirical Formula: C10H8S
Molecular Weight: 160.24
MDL number: MFCD00039599
EINECS: 208-462-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB460.80 | In Stock |
|
| 5g | RMB2078.40 | In Stock |
|
| 25g | RMB10393.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 15 °C |
| Boiling point: | 131 °C (5 mmHg) |
| Density | 1.15 |
| refractive index | 1.679-1.681 |
| Flash point: | >110°C |
| form | Liquid |
| pka | 6?+-.0.30(Predicted) |
| color | Clear light yellow to yellow |
| Water Solubility | Soluble in diethyl ether and ethanol. Slightly soluble in water and dilute alkalis. |
| InChI | InChI=1S/C10H8S/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
| InChIKey | SEXOVMIIVBKGGM-UHFFFAOYSA-N |
| SMILES | C1(S)=C2C(C=CC=C2)=CC=C1 |
| EPA Substance Registry System | 1-Naphthalenethiol (529-36-2) |
Description and Uses
1-NAT can be used as a model analyte to characterize the performance of the surface enhanced raman scattering (SERS).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-36/37/38-51-22 |
| Safety Statements | 24/25-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29309099 |
| Storage Class | 12 - Non Combustible Liquids |
| Hazard Classifications | Acute Tox. 4 Oral |




