T8830730
Dansylamide [for Albumin binding assay] , >98.0%(T) , 1431-39-6
Synonym(s):
Dansyl amide;DNSA
CAS NO.:1431-39-6
Empirical Formula: C12H14N2O2S
Molecular Weight: 250.32
MDL number: MFCD00004000
EINECS: 215-854-1
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB296.00 | In Stock |
|
| 100mg | RMB752.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-221 °C(lit.) |
| Boiling point: | 435.4±37.0 °C(Predicted) |
| Density | 1.2391 (rough estimate) |
| refractive index | 1.5950 (estimate) |
| storage temp. | −20°C |
| solubility | Dimethylformamide[soluble in] |
| solubility | soluble in Dimethylformamide |
| form | Fine Crystalline Powder |
| pka | 10.29±0.30(Predicted) |
| color | White to light yellow |
| BRN | 2217203 |
| InChI | InChI=1S/C12H14N2O2S/c1-14(2)11-7-3-6-10-9(11)5-4-8-12(10)17(13,15)16/h3-8H,1-2H3,(H2,13,15,16) |
| InChIKey | TYNBFJJKZPTRKS-UHFFFAOYSA-N |
| SMILES | C1(S(N)(=O)=O)=C2C(C(N(C)C)=CC=C2)=CC=C1 |
| CAS DataBase Reference | 1431-39-6 |
Description and Uses
5-(Dimethylamino)-1-naphthalenesulfonamide (DNSA) was used as starting reagent in the synthesis of 2,6-disubstituted pyridines, 6-substituted 2,2′-bipyridines and 6,6′-disubstituted 2,2′-bipyridines. It was also used as fluorescent probe in the determination of concentration of human carbonic anhydrase II-DNSA in solutions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29350090 |

![Dansylamide [for Albumin binding assay]](https://img.chemicalbook.com/CAS/GIF/1431-39-6.gif)




