LN7399251
3-(Dansylamino)phenylboronicacid , N/A , 75806-94-9
Synonym(s):
3-(5-Di-methyl-amino-naphtha-lene-1-sulfonyl-amino)-benzene-boronic acid;3-(Dansylamido)benzeneboronic acid
CAS NO.:75806-94-9
Empirical Formula: C18H19BN2O4S
Molecular Weight: 370.23
MDL number: MFCD00042703
EINECS: 278-319-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB2307.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 599.3±60.0 °C(Predicted) |
| Density | 1.39±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 7.81±0.10(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| Appearance | Solid Powder |
| BRN | 8012268 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C18H19BN2O4S/c1-21(2)17-10-4-9-16-15(17)8-5-11-18(16)26(24,25)20-14-7-3-6-13(12-14)19(22)23/h3-12,20,22-23H,1-2H3 |
| InChIKey | TYXMKSYBCDTGDU-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(cccc12)S(=O)(=O)Nc3cccc(c3)B(O)O |
Description and Uses
3-(Dansylamino)phenylboronic acid is an environment-sensitive fluorescent probe that can be used for in-situ imaging and quantification of sialic acid on cell membrane surfaces.
Carbohydrate ligand in cell studies1; potent boronic acid serine protease inhibitor.2
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25-22 |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![Dansylamide [for Fluorometry]](https://img.chemicalbook.com/CAS/GIF/1431-39-6.gif)
